Lesopitron

Lesopitron
(IUPAC) ime
24-[4-(4-hloro-1H-pirazol-1-il)butil]piperazin-1-il
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

pirimidin

| image = Lesopitron.png | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = Nije kontrolisana supstanca | routes_of_administration = Oralno

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  DaY | CAS_number = 132449-46-8 | ATC_prefix = none | ATC_suffix = | PubChem = 60813 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 54801 | UNII_Ref =  DaY | UNII = H1CGM4755H

| C=15 | H=21 | Cl=1 | N=6 | molecular_weight = 320,82 g/mol | smiles = Clc1cn(nc1)CCCCN3CCN(c2ncccn2)CC3 | InChI = | InChIKey = | StdInChI_Ref =  DaY | StdInChI = 1S/C15H21ClN6/c16-14-12-19-22(13-14)7-2-1-6-20-8-10-21(11-9-20)15-17-4-3-5-18-15/h3-5,12-13H,1-2,6-11H2 | StdInChIKey_Ref =  DaY | StdInChIKey = AHCPKWJUALHOPH-UHFFFAOYSA-N }

Lesopitron (E-4424) je selektivni pun agonist 5-HT1A receptora koji je strukturno srodan sa azapironima.[1] On je bio u razvoju kao anksiolitik za tretman generalizovanog anksioznog poremećaja.[2][3] Dospeo je do faze II kliničkih ispitivanja, ali je razvoj prekinut.[2][3]

Reference

  1. Haj-Dahmane S, Jolas T, Laporte AM, et al. (April 1994). „Interactions of lesopitron (E-4424) with central 5-HT1A receptors: in vitro and in vivo studies in the rat”. European Journal of Pharmacology 255 (1-3): 185–96. DOI:10.1016/0014-2999(94)90097-3. PMID 8026543. 
  2. 2,0 2,1 Micheli F (February 2001). „Lesopitron (Esteve)”. IDrugs : the Investigational Drugs Journal 4 (2): 218–24. PMID 16032484. 
  3. 3,0 3,1 Fresquet A, Sust M, Lloret A, et al. (February 2000). „Efficacy and safety of lesopitron in outpatients with generalized anxiety disorder”. The Annals of Pharmacotherapy 34 (2): 147–53. PMID 10676820. [mrtav link] Greška u referenci: Nevaljana oznaka <ref>; naziv "pmid10676820" je zadan više puta s različitim sadržajem

Povezano

Vanjske veze

Portal Medicina
Portal Hemija